func NewPublisher(pub *publisher.Publisher, hwm, bulkHWM int) *PacketbeatPublisher {
return &PacketbeatPublisher{
pub: pub,
client: pub.Connect(),
done: make(chan struct{}),
trans: make(chan common.MapStr, hwm),
flows: make(chan []common.MapStr, bulkHWM),
}
}
func NewPublisher(
pub publisher.Publisher,
hwm, bulkHWM int,
) (*PacketbeatPublisher, error) {
topo, ok := pub.(TopologyProvider)
if !ok {
return nil, errors.New("Requires topology provider")
}
return &PacketbeatPublisher{
pub: pub,
topo: topo,
geoLite: topo.GeoLite(),
ignoreOutgoing: topo.IgnoreOutgoing(),
client: pub.Connect(),
done: make(chan struct{}),
trans: make(chan common.MapStr, hwm),
flows: make(chan []common.MapStr, bulkHWM),
}, nil
}
// newModuleWrappers creates new Modules and their associated MetricSets based
// on the given configuration. It constructs the supporting filters and
// publisher client and stores it all in a moduleWrapper.
func newModuleWrappers(
modulesConfig []*common.Config,
r *mb.Register,
publisher *publisher.Publisher,
) ([]*moduleWrapper, error) {
modules, err := mb.NewModules(modulesConfig, r)
if err != nil {
return nil, err
}
// Wrap the Modules and MetricSet's.
var wrappers []*moduleWrapper
var errs multierror.Errors
for k, v := range modules {
debugf("initializing Module type %s, %T=%+v", k.Name(), k, k)
f, err := filter.New(k.Config().Filters)
if err != nil {
errs = append(errs, errors.Wrapf(err, "module %s", k.Name()))
continue
}
mw := &moduleWrapper{
Module: k,
filters: f,
pubClient: publisher.Connect(),
}
wrappers = append(wrappers, mw)
msws := make([]*metricSetWrapper, 0, len(v))
for _, ms := range v {
debugf("initializing MetricSet type %s/%s, %T=%+v",
ms.Module().Name(), ms.Name(), ms, ms)
msw := &metricSetWrapper{
MetricSet: ms,
module: mw,
stats: new(expvar.Map).Init(),
}
msws = append(msws, msw)
// Initialize expvar stats for this MetricSet.
fetches.Set(fmt.Sprintf("%s-%s", mw.Name(), msw.Name()), msw.stats)
msw.stats.Add(successesKey, 0)
msw.stats.Add(failuresKey, 0)
msw.stats.Add(eventsKey, 0)
}
mw.metricSets = msws
}
return wrappers, errs.Err()
}
func normalizeTransAddr(pub *publisher.Publisher, event common.MapStr) bool {
debugf("normalize address for: %v", event)
var srcServer, dstServer string
src, ok := event["src"].(*common.Endpoint)
debugf("has src: %v", ok)
if ok {
// check if it's outgoing transaction (as client)
isOutgoing := pub.IsPublisherIP(src.Ip)
if isOutgoing {
if pub.IgnoreOutgoing {
// duplicated transaction -> ignore it
debugf("Ignore duplicated transaction on: %s -> %s", srcServer, dstServer)
return false
}
//outgoing transaction
event["direction"] = "out"
}
srcServer = pub.GetServerName(src.Ip)
event["client_ip"] = src.Ip
event["client_port"] = src.Port
event["client_proc"] = src.Proc
event["client_server"] = srcServer
delete(event, "src")
}
dst, ok := event["dst"].(*common.Endpoint)
debugf("has dst: %v", ok)
if ok {
dstServer = pub.GetServerName(dst.Ip)
event["ip"] = dst.Ip
event["port"] = dst.Port
event["proc"] = dst.Proc
event["server"] = dstServer
delete(event, "dst")
//check if it's incoming transaction (as server)
if pub.IsPublisherIP(dst.Ip) {
// incoming transaction
event["direction"] = "in"
}
}
if pub.GeoLite != nil {
realIP, exists := event["real_ip"]
if exists && len(realIP.(common.NetString)) > 0 {
loc := pub.GeoLite.GetLocationByIP(string(realIP.(common.NetString)))
if loc != nil && loc.Latitude != 0 && loc.Longitude != 0 {
loc := fmt.Sprintf("%f, %f", loc.Latitude, loc.Longitude)
event["client_location"] = loc
}
} else {
if len(srcServer) == 0 && src != nil { // only for external IP addresses
loc := pub.GeoLite.GetLocationByIP(src.Ip)
if loc != nil && loc.Latitude != 0 && loc.Longitude != 0 {
loc := fmt.Sprintf("%f, %f", loc.Latitude, loc.Longitude)
event["client_location"] = loc
}
}
}
}
return true
}
